From Wikipedia, the free encyclopedia
MK-9470
|
Names
|
Preferred IUPAC name
N-[(2S,3S)-3-(3-Cyanophenyl)-4-(4-ethoxyphenyl)butan-2-yl]-2-methyl-2-[(5-methylpyridin-2-yl)oxy]propanamide
|
Identifiers
|
|
|
|
|
ChemSpider
|
|
|
|
UNII
|
|
InChI=1S/C29H33N3O3/c1-6-34-25-13-11-22(12-14-25)17-26(24-9-7-8-23(16-24)18-30)21(3)32-28(33)29(4,5)35-27-15-10-20(2)19-31-27/h7-16,19,21,26H,6,17H2,1-5H3,(H,32,33)/t21-,26+/m0/s1 NKey: JWBGLSNXGRDLKH-HFZDXXHNSA-N NInChI=1/C29H33N3O3/c1-6-34-25-13-11-22(12-14-25)17-26(24-9-7-8-23(16-24)18-30)21(3)32-28(33)29(4,5)35-27-15-10-20(2)19-31-27/h7-16,19,21,26H,6,17H2,1-5H3,(H,32,33)/t21-,26+/m0/s1 Key: JWBGLSNXGRDLKH-HFZDXXHNBD
|
CCOc1ccc(C[C@H]([C@H](C)NC(=O)C(C)(C)Oc2ccc(C)cn2)c3cccc(c3)C#N)cc1
|
Properties
|
|
C29H33N3O3
|
Molar mass
|
471.59 g/mol
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Chemical compound
MK-9470 is a synthetic compound, which binds to the CB1 cannabinoid receptor and functions as an inverse agonist.[1]
- ^ Burns, HD; Van Laere, K; Sanabria-Bohórquez, S; Hamill, TG; Bormans, G; Eng, WS; Gibson, R; Ryan, C; Connolly, B; Patel, S; Krause, S; Vanko, A; Van Hecken, A; Dupont, P; De Lepeleire, I; Rothenberg, P; Stoch, SA; Cote, J; Hagmann, WK; Jewell, JP; Lin, LS; Liu, P; Goulet, MT; Gottesdiener, K; Wagner, JA; de Hoon, J; Mortelmans, L; Fong, TM; Hargreaves, RJ (5 June 2007). "[18F] MK-9470, a Positron Emission Tomography (PET) Tracer for in vivo Human PET Brain Imaging of the Cannabinoid-1 Receptor". Proceedings of the National Academy of Sciences of the United States of America. 104 (23): 9800–5. Bibcode:2007PNAS..104.9800B. doi:10.1073/pnas.0703472104. PMC 1877985. PMID 17535893.
|
---|
Phytocannabinoids (comparison) | Cannabibutols | |
---|
Cannabichromenes | |
---|
Cannabicyclols | |
---|
Cannabidiols | |
---|
Cannabielsoins | |
---|
Cannabigerols | |
---|
Cannabiphorols | |
---|
Cannabinols | |
---|
Cannabitriols | |
---|
Cannabivarins | |
---|
Delta-8-tetrahydrocannabinols | |
---|
Delta-9-tetrahydrocannabinols | |
---|
Delta-10-Tetrahydrocannabinols | |
---|
Miscellaneous cannabinoids | |
---|
Active metabolites | |
---|
|
---|
Endocannabinoids | |
---|
Synthetic cannabinoid receptor agonists / neocannabinoids | Classical cannabinoids (dibenzopyrans) | |
---|
Non-classical cannabinoids | |
---|
Adamantoylindoles | |
---|
Benzimidazoles | |
---|
Benzoylindoles | |
---|
Cyclohexylphenols | |
---|
Eicosanoids | |
---|
Indazole-3- carboxamides | |
---|
Indole-3-carboxamides | |
---|
Indole-3-carboxylates | |
---|
Naphthoylindazoles | |
---|
Naphthoylindoles | |
---|
Naphthoylpyrroles | |
---|
Naphthylmethylindenes | |
---|
Naphthylmethylindoles | |
---|
Phenylacetylindoles | |
---|
Pyrazolecarboxamides | |
---|
Tetramethylcyclo- propanoylindazoles | |
---|
Tetramethylcyclo- propanoylindoles | |
---|
Others | |
---|
|
---|
Allosteric CBRTooltip Cannabinoid receptor ligands | |
---|
Endocannabinoid enhancers (inactivation inhibitors) | |
---|
Anticannabinoids (antagonists/inverse agonists/antibodies) | |
---|
|